C13H14ClF3N4O4S — CID 175134042
[3-chloro-1-methyl-5-[(3R)-3-methylmorpholin-4-yl]pyrazolo[4,5-b]pyridin-7-yl] trifluoromethanesulfonate (PubChem CID 175134042) has the molecular formula C13H14ClF3N4O4S and a molecular weight of 414.79 g/mol. Its IUPAC name is [3-chloro-1-methyl-5-[(3R)-3-methylmorpholin-4-yl]pyrazolo[4,5-b]pyridin-7-yl] trifluoromethanesulfonate.
| Compound Name | [3-chloro-1-methyl-5-[(3R)-3-methylmorpholin-4-yl]pyrazolo[4,5-b]pyridin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175134042 |
| Molecular Formula | C13H14ClF3N4O4S |
| Molecular Weight | 414.79 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | [3-chloro-1-methyl-5-[(3R)-3-methylmorpholin-4-yl]pyrazolo[4,5-b]pyridin-7-yl] trifluoromethanesulfonate |
| SMILES | C[C@@H]1COCCN1c1cc(OS(=O)(=O)C(F)(F)F)c2c(n1)c(Cl)nn2C |
| InChI | InChI=1S/C13H14ClF3N4O4S/c1-7-6-24-4-3-21(7)9-5-8(25-26(22,23)13(15,16)17)11-10(18-9)12(14)19-20(11)2/h5,7H,3-4,6H2,1-2H3/t7-/m1/s1 |
| InChIKey | MLUJLODXOKJRCF-SSDOTTSWSA-N |
| XLogP | 2.08 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.79 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|