C16H31N3O2 — CID 123877002
2-(2-ethoxycyclohexyl)-2-(4-methyl-1,4-diazepan-1-yl)acetamide (PubChem CID 123877002) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 2-(2-ethoxycyclohexyl)-2-(4-methyl-1,4-diazepan-1-yl)acetamide.
| Compound Name | 2-(2-ethoxycyclohexyl)-2-(4-methyl-1,4-diazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 123877002 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 2-(2-ethoxycyclohexyl)-2-(4-methyl-1,4-diazepan-1-yl)acetamide |
| SMILES | CCOC1CCCCC1C(C(N)=O)N1CCCN(C)CC1 |
| InChI | InChI=1S/C16H31N3O2/c1-3-21-14-8-5-4-7-13(14)15(16(17)20)19-10-6-9-18(2)11-12-19/h13-15H,3-12H2,1-2H3,(H2,17,20) |
| InChIKey | GJYHQSGPUITVFG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |