C10H19LiN2O2 — CID 135240366
lithium 2-(4-methyl-1,4-diazepan-1-yl)butanoate (PubChem CID 135240366) has the molecular formula C10H19LiN2O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is lithium 2-(4-methyl-1,4-diazepan-1-yl)butanoate.
| Compound Name | lithium 2-(4-methyl-1,4-diazepan-1-yl)butanoate |
|---|---|
| PubChem CID | 135240366 |
| Molecular Formula | C10H19LiN2O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.16 |
| IUPAC Name | lithium 2-(4-methyl-1,4-diazepan-1-yl)butanoate |
| SMILES | CCC(C(=O)[O-])N1CCCN(C)CC1.[Li+] |
| InChI | InChI=1S/C10H20N2O2.Li/c1-3-9(10(13)14)12-6-4-5-11(2)7-8-12;/h9H,3-8H2,1-2H3,(H,13,14);/q;+1/p-1 |
| InChIKey | DIQCYHOFKDZOGN-UHFFFAOYSA-M |
| XLogP | -3.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |