C23H31N3O4S — CID 123877861
octyl 2-[(3-hydroxypyridine-2-carbonyl)amino]-3-(pyridin-2-ylmethylsulfanyl)propanoate (PubChem CID 123877861) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is octyl 2-[(3-hydroxypyridine-2-carbonyl)amino]-3-(pyridin-2-ylmethylsulfanyl)propanoate.
| Compound Name | octyl 2-[(3-hydroxypyridine-2-carbonyl)amino]-3-(pyridin-2-ylmethylsulfanyl)propanoate |
|---|---|
| PubChem CID | 123877861 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | octyl 2-[(3-hydroxypyridine-2-carbonyl)amino]-3-(pyridin-2-ylmethylsulfanyl)propanoate |
| SMILES | CCCCCCCCOC(=O)C(CSCc1ccccn1)NC(=O)c1ncccc1O |
| InChI | InChI=1S/C23H31N3O4S/c1-2-3-4-5-6-9-15-30-23(29)19(17-31-16-18-11-7-8-13-24-18)26-22(28)21-20(27)12-10-14-25-21/h7-8,10-14,19,27H,2-6,9,15-17H2,1H3,(H,26,28) |
| InChIKey | PGKRVLBOMABTEF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|