C15H19ClFN3O2 — CID 123878548
tert-butyl N-[5-[[2-chloro-1-(methylideneamino)propylidene]amino]-2-fluorophenyl]carbamate (PubChem CID 123878548) has the molecular formula C15H19ClFN3O2 and a molecular weight of 327.79 g/mol. Its IUPAC name is tert-butyl N-[5-[[2-chloro-1-(methylideneamino)propylidene]amino]-2-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[5-[[2-chloro-1-(methylideneamino)propylidene]amino]-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 123878548 |
| Molecular Formula | C15H19ClFN3O2 |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | tert-butyl N-[5-[[2-chloro-1-(methylideneamino)propylidene]amino]-2-fluorophenyl]carbamate |
| SMILES | C=N/C(=N\c1ccc(F)c(NC(=O)OC(C)(C)C)c1)C(C)Cl |
| InChI | InChI=1S/C15H19ClFN3O2/c1-9(16)13(18-5)19-10-6-7-11(17)12(8-10)20-14(21)22-15(2,3)4/h6-9H,5H2,1-4H3,(H,20,21)/b19-13- |
| InChIKey | OKFGCWKKMZTZTM-UYRXBGFRSA-N |
| XLogP | 4.53 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|