C19H14BrCl3N4 — CID 123878752
1-[2-bromo-4-[3-methyl-3-(3,4,5-trichlorophenyl)-2,4-dihydropyrrol-5-yl]phenyl]-1,2,4-triazole (PubChem CID 123878752) has the molecular formula C19H14BrCl3N4 and a molecular weight of 484.61 g/mol. Its IUPAC name is 1-[2-bromo-4-[3-methyl-3-(3,4,5-trichlorophenyl)-2,4-dihydropyrrol-5-yl]phenyl]-1,2,4-triazole.
| Compound Name | 1-[2-bromo-4-[3-methyl-3-(3,4,5-trichlorophenyl)-2,4-dihydropyrrol-5-yl]phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 123878752 |
| Molecular Formula | C19H14BrCl3N4 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 481.95 |
| IUPAC Name | 1-[2-bromo-4-[3-methyl-3-(3,4,5-trichlorophenyl)-2,4-dihydropyrrol-5-yl]phenyl]-1,2,4-triazole |
| SMILES | CC1(c2cc(Cl)c(Cl)c(Cl)c2)CN=C(c2ccc(-n3cncn3)c(Br)c2)C1 |
| InChI | InChI=1S/C19H14BrCl3N4/c1-19(12-5-14(21)18(23)15(22)6-12)7-16(25-8-19)11-2-3-17(13(20)4-11)27-10-24-9-26-27/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | PCQYTFPNJZASQN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|