C27H19F2N5O3S — CID 123879083
2-amino-6-[5-[(2,4-difluorophenyl)sulfinylmethylideneamino]-6-methoxy-3-pyridinyl]-3-phenylquinazolin-4-one (PubChem CID 123879083) has the molecular formula C27H19F2N5O3S and a molecular weight of 531.54 g/mol. Its IUPAC name is 2-amino-6-[5-[(2,4-difluorophenyl)sulfinylmethylideneamino]-6-methoxy-3-pyridinyl]-3-phenylquinazolin-4-one.
| Compound Name | 2-amino-6-[5-[(2,4-difluorophenyl)sulfinylmethylideneamino]-6-methoxy-3-pyridinyl]-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 123879083 |
| Molecular Formula | C27H19F2N5O3S |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 2-amino-6-[5-[(2,4-difluorophenyl)sulfinylmethylideneamino]-6-methoxy-3-pyridinyl]-3-phenylquinazolin-4-one |
| SMILES | COc1ncc(-c2ccc3nc(N)n(-c4ccccc4)c(=O)c3c2)cc1/N=C/S(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C27H19F2N5O3S/c1-37-25-23(32-15-38(36)24-10-8-18(28)13-21(24)29)12-17(14-31-25)16-7-9-22-20(11-16)26(35)34(27(30)33-22)19-5-3-2-4-6-19/h2-15H,1H3,(H2,30,33)/b32-15+ |
| InChIKey | XRRSBKCIIAZHQL-VWJSQJICSA-N |
| XLogP | 4.78 |
| TPSA | 112.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|