C29H27N5O6S — CID 67981438
5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-N-benzyl-2-methoxy-N-methylpyridine-3-sulfonamide;formic acid (PubChem CID 67981438) has the molecular formula C29H27N5O6S and a molecular weight of 573.63 g/mol. Its IUPAC name is 5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-N-benzyl-2-methoxy-N-methylpyridine-3-sulfonamide;formic acid.
| Compound Name | 5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-N-benzyl-2-methoxy-N-methylpyridine-3-sulfonamide;formic acid |
|---|---|
| PubChem CID | 67981438 |
| Molecular Formula | C29H27N5O6S |
| Molecular Weight | 573.63 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | 5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-N-benzyl-2-methoxy-N-methylpyridine-3-sulfonamide;formic acid |
| SMILES | COc1ncc(-c2ccc3nc(N)n(-c4ccccc4)c(=O)c3c2)cc1S(=O)(=O)N(C)Cc1ccccc1.O=CO |
| InChI | InChI=1S/C28H25N5O4S.CH2O2/c1-32(18-19-9-5-3-6-10-19)38(35,36)25-16-21(17-30-26(25)37-2)20-13-14-24-23(15-20)27(34)33(28(29)31-24)22-11-7-4-8-12-22;2-1-3/h3-17H,18H2,1-2H3,(H2,29,31);1H,(H,2,3) |
| InChIKey | XARISMUTSRDIRY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 157.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|