C24H23N7O4S — CID 123757985
5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-N-(1-imino-3-methyliminopropan-2-yl)-2-methoxypyridine-3-sulfonamide (PubChem CID 123757985) has the molecular formula C24H23N7O4S and a molecular weight of 505.56 g/mol. Its IUPAC name is 5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-N-(1-imino-3-methyliminopropan-2-yl)-2-methoxypyridine-3-sulfonamide.
| Compound Name | 5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-N-(1-imino-3-methyliminopropan-2-yl)-2-methoxypyridine-3-sulfonamide |
|---|---|
| PubChem CID | 123757985 |
| Molecular Formula | C24H23N7O4S |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-N-(1-imino-3-methyliminopropan-2-yl)-2-methoxypyridine-3-sulfonamide |
| SMILES | [H]/N=C/C(/C=N/C)NS(=O)(=O)c1cc(-c2ccc3nc(N)n(-c4ccccc4)c(=O)c3c2)cnc1OC |
| InChI | InChI=1S/C24H23N7O4S/c1-27-14-17(12-25)30-36(33,34)21-11-16(13-28-22(21)35-2)15-8-9-20-19(10-15)23(32)31(24(26)29-20)18-6-4-3-5-7-18/h3-14,17,25,30H,1-2H3,(H2,26,29)/b25-12+,27-14+ |
| InChIKey | WIWLLUQQAOSUSJ-BSJLCCIXSA-N |
| XLogP | 2.04 |
| TPSA | 165.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|