C28H33N7O3Si — CID 123456652
2-trimethylsilylethyl N-[1-[5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-2-methoxy-3-pyridinyl]-2-diazenylethyl]methanimidate (PubChem CID 123456652) has the molecular formula C28H33N7O3Si and a molecular weight of 543.70 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[1-[5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-2-methoxy-3-pyridinyl]-2-diazenylethyl]methanimidate.
| Compound Name | 2-trimethylsilylethyl N-[1-[5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-2-methoxy-3-pyridinyl]-2-diazenylethyl]methanimidate |
|---|---|
| PubChem CID | 123456652 |
| Molecular Formula | C28H33N7O3Si |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | 2-trimethylsilylethyl N-[1-[5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-2-methoxy-3-pyridinyl]-2-diazenylethyl]methanimidate |
| SMILES | [H]/N=N/CC(/N=C/OCC[Si](C)(C)C)c1cc(-c2ccc3nc(N)n(-c4ccccc4)c(=O)c3c2)cnc1OC |
| InChI | InChI=1S/C28H33N7O3Si/c1-37-26-22(25(17-33-30)32-18-38-12-13-39(2,3)4)15-20(16-31-26)19-10-11-24-23(14-19)27(36)35(28(29)34-24)21-8-6-5-7-9-21/h5-11,14-16,18,25,30H,12-13,17H2,1-4H3,(H2,29,34)/b32-18+,33-30+ |
| InChIKey | ASBKHJFNJCHNFR-LRKHWXJGSA-N |
| XLogP | 5.49 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|