C15H18F2N4O7S — CID 123882531
[2-[(2-amino-2-phenylethoxy)carbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 123882531) has the molecular formula C15H18F2N4O7S and a molecular weight of 436.39 g/mol. Its IUPAC name is [2-[(2-amino-2-phenylethoxy)carbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[(2-amino-2-phenylethoxy)carbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 123882531 |
| Molecular Formula | C15H18F2N4O7S |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | [2-[(2-amino-2-phenylethoxy)carbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(CONC(=O)C1CC(F)(F)C2CN1C(=O)N2OS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H18F2N4O7S/c16-15(17)6-11(20-7-12(15)21(14(20)23)28-29(24,25)26)13(22)19-27-8-10(18)9-4-2-1-3-5-9/h1-5,10-12H,6-8,18H2,(H,19,22)(H,24,25,26) |
| InChIKey | MNCFDDUANHLRKV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 151.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|