C20H29N3O — CID 123882865
[4-(6-amino-2,3-dihydro-1H-inden-1-yl)-2-methylpiperazin-1-yl]-cyclopentylmethanone (PubChem CID 123882865) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is [4-(6-amino-2,3-dihydro-1H-inden-1-yl)-2-methylpiperazin-1-yl]-cyclopentylmethanone.
| Compound Name | [4-(6-amino-2,3-dihydro-1H-inden-1-yl)-2-methylpiperazin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 123882865 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | [4-(6-amino-2,3-dihydro-1H-inden-1-yl)-2-methylpiperazin-1-yl]-cyclopentylmethanone |
| SMILES | CC1CN(C2CCc3ccc(N)cc32)CCN1C(=O)C1CCCC1 |
| InChI | InChI=1S/C20H29N3O/c1-14-13-22(10-11-23(14)20(24)16-4-2-3-5-16)19-9-7-15-6-8-17(21)12-18(15)19/h6,8,12,14,16,19H,2-5,7,9-11,13,21H2,1H3 |
| InChIKey | PUNAOTPNGXOSAE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|