C45H68 — CID 123883503
2,7-ditert-butyl-9-[(4-tert-butyl-2-ethylcyclopentyl)-diphenylmethyl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene (PubChem CID 123883503) has the molecular formula C45H68 and a molecular weight of 609.04 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[(4-tert-butyl-2-ethylcyclopentyl)-diphenylmethyl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene.
| Compound Name | 2,7-ditert-butyl-9-[(4-tert-butyl-2-ethylcyclopentyl)-diphenylmethyl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
|---|---|
| PubChem CID | 123883503 |
| Molecular Formula | C45H68 |
| Molecular Weight | 609.04 g/mol |
| Exact Mass | 608.53 |
| IUPAC Name | 2,7-ditert-butyl-9-[(4-tert-butyl-2-ethylcyclopentyl)-diphenylmethyl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
| SMILES | CCC1CC(C(C)(C)C)CC1C(c1ccccc1)(c1ccccc1)C1C2CC(C(C)(C)C)CCC2C2CCC(C(C)(C)C)CC21 |
| InChI | InChI=1S/C45H68/c1-11-30-26-35(44(8,9)10)29-40(30)45(31-18-14-12-15-19-31,32-20-16-13-17-21-32)41-38-27-33(42(2,3)4)22-24-36(38)37-25-23-34(28-39(37)41)43(5,6)7/h12-21,30,33-41H,11,22-29H2,1-10H3 |
| InChIKey | WTTMKKSCSFOBMG-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.04 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |