C46H70Si — CID 164935866
2-[[3-[(2,7-ditert-butyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-9-yl)-diphenylmethyl]cyclopentyl]methyl]prop-2-enyl-trimethylsilane (PubChem CID 164935866) has the molecular formula C46H70Si and a molecular weight of 651.15 g/mol. Its IUPAC name is 2-[[3-[(2,7-ditert-butyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-9-yl)-diphenylmethyl]cyclopentyl]methyl]prop-2-enyl-trimethylsilane.
| Compound Name | 2-[[3-[(2,7-ditert-butyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-9-yl)-diphenylmethyl]cyclopentyl]methyl]prop-2-enyl-trimethylsilane |
|---|---|
| PubChem CID | 164935866 |
| Molecular Formula | C46H70Si |
| Molecular Weight | 651.15 g/mol |
| Exact Mass | 650.52 |
| IUPAC Name | 2-[[3-[(2,7-ditert-butyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-9-yl)-diphenylmethyl]cyclopentyl]methyl]prop-2-enyl-trimethylsilane |
| SMILES | C=C(CC1CCC(C(c2ccccc2)(c2ccccc2)C2C3CC(C(C)(C)C)CCC3C3CCC(C(C)(C)C)CC32)C1)C[Si](C)(C)C |
| InChI | InChI=1S/C46H70Si/c1-32(31-47(8,9)10)27-33-21-22-38(28-33)46(34-17-13-11-14-18-34,35-19-15-12-16-20-35)43-41-29-36(44(2,3)4)23-25-39(41)40-26-24-37(30-42(40)43)45(5,6)7/h11-20,33,36-43H,1,21-31H2,2-10H3 |
| InChIKey | XPTUYTAGDVVPRK-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.15 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|