C51H93N9 — CID 123884106
4-[3,5-bis[2,6-di(piperidin-2-yl)piperidin-4-yl]cyclohexyl]-2,6-di(piperidin-2-yl)piperidine (PubChem CID 123884106) has the molecular formula C51H93N9 and a molecular weight of 832.37 g/mol. Its IUPAC name is 4-[3,5-bis[2,6-di(piperidin-2-yl)piperidin-4-yl]cyclohexyl]-2,6-di(piperidin-2-yl)piperidine.
| Compound Name | 4-[3,5-bis[2,6-di(piperidin-2-yl)piperidin-4-yl]cyclohexyl]-2,6-di(piperidin-2-yl)piperidine |
|---|---|
| PubChem CID | 123884106 |
| Molecular Formula | C51H93N9 |
| Molecular Weight | 832.37 g/mol |
| Exact Mass | 831.76 |
| IUPAC Name | 4-[3,5-bis[2,6-di(piperidin-2-yl)piperidin-4-yl]cyclohexyl]-2,6-di(piperidin-2-yl)piperidine |
| SMILES | C1CCC(C2CC(C3CC(C4CC(C5CCCCN5)NC(C5CCCCN5)C4)CC(C4CC(C5CCCCN5)NC(C5CCCCN5)C4)C3)CC(C3CCCCN3)N2)NC1 |
| InChI | InChI=1S/C51H93N9/c1-7-19-52-40(13-1)46-28-37(29-47(58-46)41-14-2-8-20-53-41)34-25-35(38-30-48(42-15-3-9-21-54-42)59-49(31-38)43-16-4-10-22-55-43)27-36(26-34)39-32-50(44-17-5-11-23-56-44)60-51(33-39)45-18-6-12-24-57-45/h34-60H,1-33H2 |
| InChIKey | DAZSGVCVOBQNFR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.37 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |