C33H64ClN7 — CID 142779687
3,3,3-tris(1-piperidin-4-ylpiperidin-3-yl)propan-1-amine;hydrochloride (PubChem CID 142779687) has the molecular formula C33H64ClN7 and a molecular weight of 594.38 g/mol. Its IUPAC name is 3,3,3-tris(1-piperidin-4-ylpiperidin-3-yl)propan-1-amine;hydrochloride.
| Compound Name | 3,3,3-tris(1-piperidin-4-ylpiperidin-3-yl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 142779687 |
| Molecular Formula | C33H64ClN7 |
| Molecular Weight | 594.38 g/mol |
| Exact Mass | 593.49 |
| IUPAC Name | 3,3,3-tris(1-piperidin-4-ylpiperidin-3-yl)propan-1-amine;hydrochloride |
| SMILES | Cl.NCCC(C1CCCN(C2CCNCC2)C1)(C1CCCN(C2CCNCC2)C1)C1CCCN(C2CCNCC2)C1 |
| InChI | InChI=1S/C33H63N7.ClH/c34-14-13-33(27-4-1-21-38(24-27)30-7-15-35-16-8-30,28-5-2-22-39(25-28)31-9-17-36-18-10-31)29-6-3-23-40(26-29)32-11-19-37-20-12-32;/h27-32,35-37H,1-26,34H2;1H |
| InChIKey | VYBZEPBPXNFYPK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 71.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |