C20H25FN6O2 — CID 123889747
methyl 4-amino-6-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]carbamoylamino]pyridine-3-carboximidate (PubChem CID 123889747) has the molecular formula C20H25FN6O2 and a molecular weight of 400.46 g/mol. Its IUPAC name is methyl 4-amino-6-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]carbamoylamino]pyridine-3-carboximidate.
| Compound Name | methyl 4-amino-6-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]carbamoylamino]pyridine-3-carboximidate |
|---|---|
| PubChem CID | 123889747 |
| Molecular Formula | C20H25FN6O2 |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | methyl 4-amino-6-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]carbamoylamino]pyridine-3-carboximidate |
| SMILES | [H]/N=C(\OC)c1cnc(NC(=O)NC2CCCN(Cc3ccccc3F)C2)cc1N |
| InChI | InChI=1S/C20H25FN6O2/c1-29-19(23)15-10-24-18(9-17(15)22)26-20(28)25-14-6-4-8-27(12-14)11-13-5-2-3-7-16(13)21/h2-3,5,7,9-10,14,23H,4,6,8,11-12H2,1H3,(H4,22,24,25,26,28)/b23-19- |
| InChIKey | JDTBXYORLILPCE-NMWGTECJSA-N |
| XLogP | 2.56 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|