C13H24N2 — CID 123889869
N-(cyclohexa-1,3-dien-1-ylmethyl)-N'-methyl-N'-propylethane-1,2-diamine (PubChem CID 123889869) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N-(cyclohexa-1,3-dien-1-ylmethyl)-N'-methyl-N'-propylethane-1,2-diamine.
| Compound Name | N-(cyclohexa-1,3-dien-1-ylmethyl)-N'-methyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 123889869 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N-(cyclohexa-1,3-dien-1-ylmethyl)-N'-methyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(C)CCNCC1=CC=CCC1 |
| InChI | InChI=1S/C13H24N2/c1-3-10-15(2)11-9-14-12-13-7-5-4-6-8-13/h4-5,7,14H,3,6,8-12H2,1-2H3 |
| InChIKey | YNTORTHGHYTAGJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|