C24H40O4 — CID 123890479
methyl 3-[[6-(3-hydroxy-3-methylbutyl)-3a,6-dimethyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl]oxy]prop-2-enoate (PubChem CID 123890479) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is methyl 3-[[6-(3-hydroxy-3-methylbutyl)-3a,6-dimethyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl]oxy]prop-2-enoate.
| Compound Name | methyl 3-[[6-(3-hydroxy-3-methylbutyl)-3a,6-dimethyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl]oxy]prop-2-enoate |
|---|---|
| PubChem CID | 123890479 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | methyl 3-[[6-(3-hydroxy-3-methylbutyl)-3a,6-dimethyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl]oxy]prop-2-enoate |
| SMILES | COC(=O)C=COC1CCC2C3CCCC(C)(CCC(C)(C)O)C3CCC12C |
| InChI | InChI=1S/C24H40O4/c1-22(2,26)14-15-23(3)12-6-7-17-18(23)10-13-24(4)19(17)8-9-20(24)28-16-11-21(25)27-5/h11,16-20,26H,6-10,12-15H2,1-5H3 |
| InChIKey | COKSORWEILMLDS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|