C20H32O3 — CID 177493413
methyl (2Z)-2-[(3S,3aS)-3-methoxy-3a,6,6-trimethyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-ylidene]acetate (PubChem CID 177493413) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is methyl (2Z)-2-[(3S,3aS)-3-methoxy-3a,6,6-trimethyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[(3S,3aS)-3-methoxy-3a,6,6-trimethyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-ylidene]acetate |
|---|---|
| PubChem CID | 177493413 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | methyl (2Z)-2-[(3S,3aS)-3-methoxy-3a,6,6-trimethyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-ylidene]acetate |
| SMILES | COC(=O)/C=C1/CCC2C(CC[C@@]3(C)C2CC[C@@H]3OC)C1(C)C |
| InChI | InChI=1S/C20H32O3/c1-19(2)13(12-18(21)23-5)6-7-14-15(19)10-11-20(3)16(14)8-9-17(20)22-4/h12,14-17H,6-11H2,1-5H3/b13-12-/t14?,15?,16?,17-,20-/m0/s1 |
| InChIKey | WQNUUKRBROGMTN-NJAIIWGHSA-N |
| XLogP | 4.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|