C19H30N2O7 — CID 123891808
3-[2-[2-[3-(3-cyclopentyl-2,5-dihydroxypyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoic acid (PubChem CID 123891808) has the molecular formula C19H30N2O7 and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-[2-[2-[3-(3-cyclopentyl-2,5-dihydroxypyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[3-(3-cyclopentyl-2,5-dihydroxypyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 123891808 |
| Molecular Formula | C19H30N2O7 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 3-[2-[2-[3-(3-cyclopentyl-2,5-dihydroxypyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOCCNC(=O)CCn1c(O)cc(C2CCCC2)c1O |
| InChI | InChI=1S/C19H30N2O7/c22-16(20-7-10-28-12-11-27-9-6-18(24)25)5-8-21-17(23)13-15(19(21)26)14-3-1-2-4-14/h13-14,23,26H,1-12H2,(H,20,22)(H,24,25) |
| InChIKey | FVIRVJHYMNJDJN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|