C11H13ClN4O — CID 123892807
N-(4-chloro-1-methylindazol-3-yl)-2-(methylamino)acetamide (PubChem CID 123892807) has the molecular formula C11H13ClN4O and a molecular weight of 252.70 g/mol. Its IUPAC name is N-(4-chloro-1-methylindazol-3-yl)-2-(methylamino)acetamide.
| Compound Name | N-(4-chloro-1-methylindazol-3-yl)-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 123892807 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | N-(4-chloro-1-methylindazol-3-yl)-2-(methylamino)acetamide |
| SMILES | CNCC(=O)Nc1nn(C)c2cccc(Cl)c12 |
| InChI | InChI=1S/C11H13ClN4O/c1-13-6-9(17)14-11-10-7(12)4-3-5-8(10)16(2)15-11/h3-5,13H,6H2,1-2H3,(H,14,15,17) |
| InChIKey | OGQIKGQTKCYXCI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |