About N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine
N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine (PubChem CID 84689488) has the molecular formula C10H13ClN4
and a molecular weight of 224.69 g/mol. Its IUPAC name is N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine |
| PubChem CID | 84689488 |
| Molecular Formula | C10H13ClN4 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine |
| SMILES | Cn1nc(NCCN)c2c(Cl)cccc21 |
| InChI | InChI=1S/C10H13ClN4/c1-15-8-4-2-3-7(11)9(8)10(14-15)13-6-5-12/h2-4H,5-6,12H2,1H3,(H,13,14) |
| InChIKey | MLSXIRKZKPYWSZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine?
The IUPAC name of N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine (CID 84689488) is N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine is Cn1nc(NCCN)c2c(Cl)cccc21.
What is the InChIKey of N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine?
The InChIKey is MLSXIRKZKPYWSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN4/c1-15-8-4-2-3-7(11)9(8)10(14-15)13-6-5-12/h2-4H,5-6,12H2,1H3,(H,13,14).
What are the key properties of N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine?
N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine has a molecular weight of 224.69 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine is sourced from PubChem (CID 84689488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).