C10H13ClN4 — CID 84689488
N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine (PubChem CID 84689488) has the molecular formula C10H13ClN4 and a molecular weight of 224.69 g/mol. Its IUPAC name is N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine.
| Compound Name | N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 84689488 |
| Molecular Formula | C10H13ClN4 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N'-(4-chloro-1-methylindazol-3-yl)ethane-1,2-diamine |
| SMILES | Cn1nc(NCCN)c2c(Cl)cccc21 |
| InChI | InChI=1S/C10H13ClN4/c1-15-8-4-2-3-7(11)9(8)10(14-15)13-6-5-12/h2-4H,5-6,12H2,1H3,(H,13,14) |
| InChIKey | MLSXIRKZKPYWSZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |