C15H33NO2 — CID 123893755
N-[2-(3,4-dimethylhexoxy)ethyl]-3-methoxybutan-1-amine (PubChem CID 123893755) has the molecular formula C15H33NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is N-[2-(3,4-dimethylhexoxy)ethyl]-3-methoxybutan-1-amine.
| Compound Name | N-[2-(3,4-dimethylhexoxy)ethyl]-3-methoxybutan-1-amine |
|---|---|
| PubChem CID | 123893755 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | N-[2-(3,4-dimethylhexoxy)ethyl]-3-methoxybutan-1-amine |
| SMILES | CCC(C)C(C)CCOCCNCCC(C)OC |
| InChI | InChI=1S/C15H33NO2/c1-6-13(2)14(3)8-11-18-12-10-16-9-7-15(4)17-5/h13-16H,6-12H2,1-5H3 |
| InChIKey | VYQARCXRKQDJAP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|