C19H23Cl2N7O — CID 123893767
1-(2,6-dichloro-4-pyridinyl)-3-[[5-ethanimidoyl-4-propan-2-yl-6-(prop-2-enylamino)-2-pyridinyl]amino]urea (PubChem CID 123893767) has the molecular formula C19H23Cl2N7O and a molecular weight of 436.35 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-[[5-ethanimidoyl-4-propan-2-yl-6-(prop-2-enylamino)-2-pyridinyl]amino]urea.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-[[5-ethanimidoyl-4-propan-2-yl-6-(prop-2-enylamino)-2-pyridinyl]amino]urea |
|---|---|
| PubChem CID | 123893767 |
| Molecular Formula | C19H23Cl2N7O |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-[[5-ethanimidoyl-4-propan-2-yl-6-(prop-2-enylamino)-2-pyridinyl]amino]urea |
| SMILES | [H]/N=C(\C)c1c(C(C)C)cc(NNC(=O)Nc2cc(Cl)nc(Cl)c2)nc1NCC=C |
| InChI | InChI=1S/C19H23Cl2N7O/c1-5-6-23-18-17(11(4)22)13(10(2)3)9-16(26-18)27-28-19(29)24-12-7-14(20)25-15(21)8-12/h5,7-10,22H,1,6H2,2-4H3,(H2,23,26,27)(H2,24,25,28,29)/b22-11+ |
| InChIKey | KEZIIWAGENYYSI-SSDVNMTOSA-N |
| XLogP | 5.04 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|