C46H60N12 — CID 123894500
2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine;2,5-dihexyl-3,6-bis(5-methylpyrimidin-2-yl)pyrazine (PubChem CID 123894500) has the molecular formula C46H60N12 and a molecular weight of 781.07 g/mol. Its IUPAC name is 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine;2,5-dihexyl-3,6-bis(5-methylpyrimidin-2-yl)pyrazine.
| Compound Name | 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine;2,5-dihexyl-3,6-bis(5-methylpyrimidin-2-yl)pyrazine |
|---|---|
| PubChem CID | 123894500 |
| Molecular Formula | C46H60N12 |
| Molecular Weight | 781.07 g/mol |
| Exact Mass | 780.51 |
| IUPAC Name | 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine;2,5-dihexyl-3,6-bis(5-methylpyrimidin-2-yl)pyrazine |
| SMILES | CCCCCCc1nc(-c2ncc(C)cn2)c(CCCCCC)nc1-c1ncc(C)cn1.CCCc1nc(-c2ncc(C)cn2)c(CCC)nc1-c1ncc(C)cn1 |
| InChI | InChI=1S/C26H36N6.C20H24N6/c1-5-7-9-11-13-21-23(25-27-15-19(3)16-28-25)32-22(14-12-10-8-6-2)24(31-21)26-29-17-20(4)18-30-26;1-5-7-15-17(19-21-9-13(3)10-22-19)26-16(8-6-2)18(25-15)20-23-11-14(4)12-24-20/h15-18H,5-14H2,1-4H3;9-12H,5-8H2,1-4H3 |
| InChIKey | KVJODXZPYPBBKZ-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 154.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.07 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|