C16H26N4O6 — CID 123895707
N-(6-aminohexyl)-1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-carboxamide (PubChem CID 123895707) has the molecular formula C16H26N4O6 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-(6-aminohexyl)-1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-carboxamide.
| Compound Name | N-(6-aminohexyl)-1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123895707 |
| Molecular Formula | C16H26N4O6 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-(6-aminohexyl)-1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-carboxamide |
| SMILES | NCCCCCCNC(=O)c1cn([C@@H]2CC(O)[C@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H26N4O6/c17-5-3-1-2-4-6-18-14(23)10-8-20(16(25)19-15(10)24)13-7-11(22)12(9-21)26-13/h8,11-13,21-22H,1-7,9,17H2,(H,18,23)(H,19,24,25)/t11?,12-,13-/m0/s1 |
| InChIKey | GUUJLNMLJJCWCF-SPOOISQMSA-N |
| XLogP | -1.57 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|