C49H52F4N2O6 — CID 123897751
[[[11-(2-ethylhexyl)-5-[2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoyl]benzo[a]carbazol-8-yl]-[4-(1-methoxypropan-2-yloxy)-2-methylphenyl]methylidene]amino] acetate (PubChem CID 123897751) has the molecular formula C49H52F4N2O6 and a molecular weight of 840.95 g/mol. Its IUPAC name is [[[11-(2-ethylhexyl)-5-[2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoyl]benzo[a]carbazol-8-yl]-[4-(1-methoxypropan-2-yloxy)-2-methylphenyl]methylidene]amino] acetate.
| Compound Name | [[[11-(2-ethylhexyl)-5-[2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoyl]benzo[a]carbazol-8-yl]-[4-(1-methoxypropan-2-yloxy)-2-methylphenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 123897751 |
| Molecular Formula | C49H52F4N2O6 |
| Molecular Weight | 840.95 g/mol |
| Exact Mass | 840.38 |
| IUPAC Name | [[[11-(2-ethylhexyl)-5-[2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoyl]benzo[a]carbazol-8-yl]-[4-(1-methoxypropan-2-yloxy)-2-methylphenyl]methylidene]amino] acetate |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=NOC(C)=O)c3ccc(OC(C)COC)cc3C)cc2c2cc(C(=O)c3ccc(OCC(F)(F)C(F)F)cc3C)c3ccccc3c21 |
| InChI | InChI=1S/C49H52F4N2O6/c1-8-10-13-33(9-2)26-55-44-21-16-34(45(54-61-32(6)56)37-19-18-36(23-29(37)3)60-31(5)27-58-7)24-41(44)42-25-43(39-14-11-12-15-40(39)46(42)55)47(57)38-20-17-35(22-30(38)4)59-28-49(52,53)48(50)51/h11-12,14-25,31,33,48H,8-10,13,26-28H2,1-7H3 |
| InChIKey | ULHZNRKTQRZOOL-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 88.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.95 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|