C12H12ClF2NO2 — CID 123901268
(3-amino-4-chlorophenyl) 3-(2,2-difluorocyclopropyl)propanoate (PubChem CID 123901268) has the molecular formula C12H12ClF2NO2 and a molecular weight of 275.68 g/mol. Its IUPAC name is (3-amino-4-chlorophenyl) 3-(2,2-difluorocyclopropyl)propanoate.
| Compound Name | (3-amino-4-chlorophenyl) 3-(2,2-difluorocyclopropyl)propanoate |
|---|---|
| PubChem CID | 123901268 |
| Molecular Formula | C12H12ClF2NO2 |
| Molecular Weight | 275.68 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | (3-amino-4-chlorophenyl) 3-(2,2-difluorocyclopropyl)propanoate |
| SMILES | Nc1cc(OC(=O)CCC2CC2(F)F)ccc1Cl |
| InChI | InChI=1S/C12H12ClF2NO2/c13-9-3-2-8(5-10(9)16)18-11(17)4-1-7-6-12(7,14)15/h2-3,5,7H,1,4,6,16H2 |
| InChIKey | XTANKALTLGESPW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.68 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|