C15H8F17NO5 — CID 123906704
(2,5-dihydroxypyrrol-1-yl) 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl carbonate (PubChem CID 123906704) has the molecular formula C15H8F17NO5 and a molecular weight of 605.20 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl carbonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl carbonate |
|---|---|
| PubChem CID | 123906704 |
| Molecular Formula | C15H8F17NO5 |
| Molecular Weight | 605.20 g/mol |
| Exact Mass | 605.01 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl carbonate |
| SMILES | O=C(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)On1c(O)ccc1O |
| InChI | InChI=1S/C15H8F17NO5/c16-8(17,3-4-37-7(36)38-33-5(34)1-2-6(33)35)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)32/h1-2,34-35H,3-4H2 |
| InChIKey | FDVBGLKBCMGUFW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.20 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|