C17H13N3O2 — CID 123906723
1-methyl-2-phenyl-6H-pyrrolo[2,3-e]indazole-3-carboxylic acid (PubChem CID 123906723) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-methyl-2-phenyl-6H-pyrrolo[2,3-e]indazole-3-carboxylic acid.
| Compound Name | 1-methyl-2-phenyl-6H-pyrrolo[2,3-e]indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 123906723 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-methyl-2-phenyl-6H-pyrrolo[2,3-e]indazole-3-carboxylic acid |
| SMILES | Cn1c(-c2ccccc2)c(C(=O)O)c2ccc3[nH]ncc3c21 |
| InChI | InChI=1S/C17H13N3O2/c1-20-15(10-5-3-2-4-6-10)14(17(21)22)11-7-8-13-12(16(11)20)9-18-19-13/h2-9H,1H3,(H,18,19)(H,21,22) |
| InChIKey | QQLVSINBIAMOJD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |