C21H42O2 — CID 123908896
2-(2,4,4,7,7,9,9-heptamethylundecan-2-yloxymethyl)oxirane (PubChem CID 123908896) has the molecular formula C21H42O2 and a molecular weight of 326.57 g/mol. Its IUPAC name is 2-(2,4,4,7,7,9,9-heptamethylundecan-2-yloxymethyl)oxirane.
| Compound Name | 2-(2,4,4,7,7,9,9-heptamethylundecan-2-yloxymethyl)oxirane |
|---|---|
| PubChem CID | 123908896 |
| Molecular Formula | C21H42O2 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.32 |
| IUPAC Name | 2-(2,4,4,7,7,9,9-heptamethylundecan-2-yloxymethyl)oxirane |
| SMILES | CCC(C)(C)CC(C)(C)CCC(C)(C)CC(C)(C)OCC1CO1 |
| InChI | InChI=1S/C21H42O2/c1-10-18(2,3)15-19(4,5)11-12-20(6,7)16-21(8,9)23-14-17-13-22-17/h17H,10-16H2,1-9H3 |
| InChIKey | QCZMTOAVVYRCOZ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|