C40H26N4O — CID 123910961
11-oxo-7,17-diphenyl-7-(2-phenylethyl)-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4(9),5,12(20),13,15,17-octaene-6,15-dicarbonitrile (PubChem CID 123910961) has the molecular formula C40H26N4O and a molecular weight of 578.68 g/mol. Its IUPAC name is 11-oxo-7,17-diphenyl-7-(2-phenylethyl)-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4(9),5,12(20),13,15,17-octaene-6,15-dicarbonitrile.
| Compound Name | 11-oxo-7,17-diphenyl-7-(2-phenylethyl)-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4(9),5,12(20),13,15,17-octaene-6,15-dicarbonitrile |
|---|---|
| PubChem CID | 123910961 |
| Molecular Formula | C40H26N4O |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | 11-oxo-7,17-diphenyl-7-(2-phenylethyl)-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4(9),5,12(20),13,15,17-octaene-6,15-dicarbonitrile |
| SMILES | N#CC1=Cc2nc3c4ccc(-c5ccccc5)c5c(C#N)ccc(c(=O)n3c2CC1(CCc1ccccc1)c1ccccc1)c54 |
| InChI | InChI=1S/C40H26N4O/c41-24-28-16-17-33-37-32(19-18-31(36(28)37)27-12-6-2-7-13-27)38-43-34-22-30(25-42)40(29-14-8-3-9-15-29,23-35(34)44(38)39(33)45)21-20-26-10-4-1-5-11-26/h1-19,22H,20-21,23H2 |
| InChIKey | BESBVBYRVSALDO-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 81.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |