C26H9N7O3 — CID 71113739
11,16,18-trioxo-17-phenyl-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-6,7-dicarbonitrile (PubChem CID 71113739) has the molecular formula C26H9N7O3 and a molecular weight of 467.40 g/mol. Its IUPAC name is 11,16,18-trioxo-17-phenyl-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-6,7-dicarbonitrile.
| Compound Name | 11,16,18-trioxo-17-phenyl-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-6,7-dicarbonitrile |
|---|---|
| PubChem CID | 71113739 |
| Molecular Formula | C26H9N7O3 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 11,16,18-trioxo-17-phenyl-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-6,7-dicarbonitrile |
| SMILES | N#Cc1nc2nc3c4ccc5c6c(ccc(c(=O)n3c2nc1C#N)c64)C(=O)N(c1ccccc1)C5=O |
| InChI | InChI=1S/C26H9N7O3/c27-10-17-18(11-28)30-23-21(29-17)31-22-13-6-7-15-20-16(9-8-14(19(13)20)26(36)33(22)23)25(35)32(24(15)34)12-4-2-1-3-5-12/h1-9H |
| InChIKey | STNQWSZXWJRDAZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 145.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|