C27H12N6O3 — CID 71114107
21-pyridin-2-yl-3,5,12,14,21-pentazaheptacyclo[17.6.2.02,14.04,13.06,11.016,26.023,27]heptacosa-1(26),2,4,6,8,10,12,16,18,23(27),24-undecaene-15,20,22-trione (PubChem CID 71114107) has the molecular formula C27H12N6O3 and a molecular weight of 468.43 g/mol. Its IUPAC name is 21-pyridin-2-yl-3,5,12,14,21-pentazaheptacyclo[17.6.2.02,14.04,13.06,11.016,26.023,27]heptacosa-1(26),2,4,6,8,10,12,16,18,23(27),24-undecaene-15,20,22-trione.
| Compound Name | 21-pyridin-2-yl-3,5,12,14,21-pentazaheptacyclo[17.6.2.02,14.04,13.06,11.016,26.023,27]heptacosa-1(26),2,4,6,8,10,12,16,18,23(27),24-undecaene-15,20,22-trione |
|---|---|
| PubChem CID | 71114107 |
| Molecular Formula | C27H12N6O3 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 21-pyridin-2-yl-3,5,12,14,21-pentazaheptacyclo[17.6.2.02,14.04,13.06,11.016,26.023,27]heptacosa-1(26),2,4,6,8,10,12,16,18,23(27),24-undecaene-15,20,22-trione |
| SMILES | O=C1c2ccc3c(=O)n4c5nc6ccccc6nc5nc4c4ccc(c2c34)C(=O)N1c1ccccn1 |
| InChI | InChI=1S/C27H12N6O3/c34-25-15-9-8-13-20-14(10-11-16(21(15)20)26(35)32(25)19-7-3-4-12-28-19)27(36)33-23(13)31-22-24(33)30-18-6-2-1-5-17(18)29-22/h1-12H |
| InChIKey | BFDVSIGJEREPRY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 110.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|