C26H11N5O7 — CID 89286189
6,7-dinitro-17-phenyl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione (PubChem CID 89286189) has the molecular formula C26H11N5O7 and a molecular weight of 505.40 g/mol. Its IUPAC name is 6,7-dinitro-17-phenyl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione.
| Compound Name | 6,7-dinitro-17-phenyl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione |
|---|---|
| PubChem CID | 89286189 |
| Molecular Formula | C26H11N5O7 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 6,7-dinitro-17-phenyl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione |
| SMILES | O=C1c2ccc3c(=O)n4c5cc([N+](=O)[O-])c([N+](=O)[O-])cc5nc4c4ccc(c2c34)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C26H11N5O7/c32-24-15-7-6-13-21-14(8-9-16(22(15)21)25(33)28(24)12-4-2-1-3-5-12)26(34)29-18-11-20(31(37)38)19(30(35)36)10-17(18)27-23(13)29/h1-11H |
| InChIKey | QEESRPREKUXDCB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 158.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|