C28H11N7O7 — CID 89286100
17-naphthalen-1-yl-6,7-dinitro-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione (PubChem CID 89286100) has the molecular formula C28H11N7O7 and a molecular weight of 557.44 g/mol. Its IUPAC name is 17-naphthalen-1-yl-6,7-dinitro-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione.
| Compound Name | 17-naphthalen-1-yl-6,7-dinitro-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
|---|---|
| PubChem CID | 89286100 |
| Molecular Formula | C28H11N7O7 |
| Molecular Weight | 557.44 g/mol |
| Exact Mass | 557.07 |
| IUPAC Name | 17-naphthalen-1-yl-6,7-dinitro-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
| SMILES | O=C1c2ccc3c(=O)n4c5nc([N+](=O)[O-])c([N+](=O)[O-])nc5nc4c4ccc(c2c34)C(=O)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C28H11N7O7/c36-26-16-9-8-14-19-15(28(38)33-22(14)29-21-23(33)31-25(35(41)42)24(30-21)34(39)40)10-11-17(20(16)19)27(37)32(26)18-7-3-5-12-4-1-2-6-13(12)18/h1-11H |
| InChIKey | BOCUJXZMOMLHCY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 183.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|