C30H14N4O5 — CID 58301289
17-naphthalen-1-yl-6-nitro-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione (PubChem CID 58301289) has the molecular formula C30H14N4O5 and a molecular weight of 510.47 g/mol. Its IUPAC name is 17-naphthalen-1-yl-6-nitro-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione.
| Compound Name | 17-naphthalen-1-yl-6-nitro-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
|---|---|
| PubChem CID | 58301289 |
| Molecular Formula | C30H14N4O5 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 17-naphthalen-1-yl-6-nitro-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
| SMILES | O=C1c2ccc3c(=O)n4c5ccc([N+](=O)[O-])cc5nc4c4ccc(c2c34)C(=O)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C30H14N4O5/c35-28-19-11-12-21-26-20(29(36)33(30(21)37)23-7-3-5-15-4-1-2-6-17(15)23)10-9-18(25(19)26)27-31-22-14-16(34(38)39)8-13-24(22)32(27)28/h1-14H |
| InChIKey | RDBMHMMEBHZHTM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|