About 7-methylazepin-2-imine
7-methylazepin-2-imine (PubChem CID 123916247) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 7-methylazepin-2-imine.
Molecular Properties
| Compound Name | 7-methylazepin-2-imine |
| PubChem CID | 123916247 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 7-methylazepin-2-imine |
| SMILES | [H]/N=c1\ccccc(C)n1 |
| InChI | InChI=1S/C7H8N2/c1-6-4-2-3-5-7(8)9-6/h2-5,8H,1H3/b8-7+ |
| InChIKey | YGLBVFIOXGXCQL-BQYQJAHWSA-N |
| XLogP | 0.87 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methylazepin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylazepin-2-imine?
The IUPAC name of 7-methylazepin-2-imine (CID 123916247) is 7-methylazepin-2-imine.
What is the SMILES notation for 7-methylazepin-2-imine?
The canonical SMILES for 7-methylazepin-2-imine is [H]/N=c1\ccccc(C)n1.
What is the InChIKey of 7-methylazepin-2-imine?
The InChIKey is YGLBVFIOXGXCQL-BQYQJAHWSA-N. The full InChI is InChI=1S/C7H8N2/c1-6-4-2-3-5-7(8)9-6/h2-5,8H,1H3/b8-7+.
What are the key properties of 7-methylazepin-2-imine?
7-methylazepin-2-imine has a molecular weight of 120.15 g/mol, XLogP of 0.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylazepin-2-imine is sourced from PubChem (CID 123916247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).