C10H16N2O3S2 — CID 123916430
3-ethyl-6-hydroxy-1,5-bis(2-sulfanylethyl)pyrimidine-2,4-dione (PubChem CID 123916430) has the molecular formula C10H16N2O3S2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-ethyl-6-hydroxy-1,5-bis(2-sulfanylethyl)pyrimidine-2,4-dione.
| Compound Name | 3-ethyl-6-hydroxy-1,5-bis(2-sulfanylethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123916430 |
| Molecular Formula | C10H16N2O3S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 3-ethyl-6-hydroxy-1,5-bis(2-sulfanylethyl)pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)c(CCS)c(O)n(CCS)c1=O |
| InChI | InChI=1S/C10H16N2O3S2/c1-2-11-8(13)7(3-5-16)9(14)12(4-6-17)10(11)15/h14,16-17H,2-6H2,1H3 |
| InChIKey | OECCSAXVMDVVPZ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|