C15H12BrNO7S — CID 123917694
2-[4-bromo-3-(4-methoxyphenyl)-1,2-thiazol-5-yl]ethane-1,1,1-tricarboxylic acid (PubChem CID 123917694) has the molecular formula C15H12BrNO7S and a molecular weight of 430.23 g/mol. Its IUPAC name is 2-[4-bromo-3-(4-methoxyphenyl)-1,2-thiazol-5-yl]ethane-1,1,1-tricarboxylic acid.
| Compound Name | 2-[4-bromo-3-(4-methoxyphenyl)-1,2-thiazol-5-yl]ethane-1,1,1-tricarboxylic acid |
|---|---|
| PubChem CID | 123917694 |
| Molecular Formula | C15H12BrNO7S |
| Molecular Weight | 430.23 g/mol |
| Exact Mass | 428.95 |
| IUPAC Name | 2-[4-bromo-3-(4-methoxyphenyl)-1,2-thiazol-5-yl]ethane-1,1,1-tricarboxylic acid |
| SMILES | COc1ccc(-c2nsc(CC(C(=O)O)(C(=O)O)C(=O)O)c2Br)cc1 |
| InChI | InChI=1S/C15H12BrNO7S/c1-24-8-4-2-7(3-5-8)11-10(16)9(25-17-11)6-15(12(18)19,13(20)21)14(22)23/h2-5H,6H2,1H3,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | MSYQZYSCFGZOMM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|