C19H20ClN3O — CID 123918313
4-[1-(4-chlorophenyl)-7,8-dihydrocycloocta[c]pyrazol-3-yl]morpholine (PubChem CID 123918313) has the molecular formula C19H20ClN3O and a molecular weight of 341.84 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)-7,8-dihydrocycloocta[c]pyrazol-3-yl]morpholine.
| Compound Name | 4-[1-(4-chlorophenyl)-7,8-dihydrocycloocta[c]pyrazol-3-yl]morpholine |
|---|---|
| PubChem CID | 123918313 |
| Molecular Formula | C19H20ClN3O |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-[1-(4-chlorophenyl)-7,8-dihydrocycloocta[c]pyrazol-3-yl]morpholine |
| SMILES | Clc1ccc(-n2nc(N3CCOCC3)c3c2=CCCC=CC=3)cc1 |
| InChI | InChI=1S/C19H20ClN3O/c20-15-7-9-16(10-8-15)23-18-6-4-2-1-3-5-17(18)19(21-23)22-11-13-24-14-12-22/h1,3,5-10H,2,4,11-14H2 |
| InChIKey | CIIZIPRYJNVLGX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |