C13H7ClN2O3 — CID 123921843
1-chloro-6-oxo-5H-benzo[c][1,8]naphthyridine-8-carboxylic acid (PubChem CID 123921843) has the molecular formula C13H7ClN2O3 and a molecular weight of 274.66 g/mol. Its IUPAC name is 1-chloro-6-oxo-5H-benzo[c][1,8]naphthyridine-8-carboxylic acid.
| Compound Name | 1-chloro-6-oxo-5H-benzo[c][1,8]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 123921843 |
| Molecular Formula | C13H7ClN2O3 |
| Molecular Weight | 274.66 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 1-chloro-6-oxo-5H-benzo[c][1,8]naphthyridine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)c(=O)[nH]c1nccc(Cl)c12 |
| InChI | InChI=1S/C13H7ClN2O3/c14-9-3-4-15-11-10(9)7-2-1-6(13(18)19)5-8(7)12(17)16-11/h1-5H,(H,18,19)(H,15,16,17) |
| InChIKey | LGGIZHWFIUODQY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.66 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|