C11H14N2 — CID 123922072
3,6-diethyl-4H-azepine-2-carbonitrile (PubChem CID 123922072) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 3,6-diethyl-4H-azepine-2-carbonitrile.
| Compound Name | 3,6-diethyl-4H-azepine-2-carbonitrile |
|---|---|
| PubChem CID | 123922072 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3,6-diethyl-4H-azepine-2-carbonitrile |
| SMILES | CCC1=CCC(CC)=C(C#N)N=C1 |
| InChI | InChI=1S/C11H14N2/c1-3-9-5-6-10(4-2)11(7-12)13-8-9/h5,8H,3-4,6H2,1-2H3 |
| InChIKey | YGZZWTMYDFDKHE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |