C22H34N4O2 — CID 123923564
1-[[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]amino]-2-(7-ethyl-2-bicyclo[3.3.1]nonanyl)ethanol (PubChem CID 123923564) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-[[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]amino]-2-(7-ethyl-2-bicyclo[3.3.1]nonanyl)ethanol.
| Compound Name | 1-[[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]amino]-2-(7-ethyl-2-bicyclo[3.3.1]nonanyl)ethanol |
|---|---|
| PubChem CID | 123923564 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 1-[[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]amino]-2-(7-ethyl-2-bicyclo[3.3.1]nonanyl)ethanol |
| SMILES | CCC1CC2CCC(CC(O)Nc3cnn(Cc4c(C)noc4C)c3)C(C1)C2 |
| InChI | InChI=1S/C22H34N4O2/c1-4-16-7-17-5-6-18(19(8-16)9-17)10-22(27)24-20-11-23-26(12-20)13-21-14(2)25-28-15(21)3/h11-12,16-19,22,24,27H,4-10,13H2,1-3H3 |
| InChIKey | YRRZSISIZIWSGB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|