C14H15N3O3S — CID 123924318
2-[5-(methylideneamino)hexa-2,4-dien-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 123924318) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-[5-(methylideneamino)hexa-2,4-dien-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 2-[5-(methylideneamino)hexa-2,4-dien-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 123924318 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-[5-(methylideneamino)hexa-2,4-dien-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | C=NC(C)=CC=C(C)N1C(=O)Nc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C14H15N3O3S/c1-10(15-3)8-9-11(2)17-14(18)16-12-6-4-5-7-13(12)21(17,19)20/h4-9H,3H2,1-2H3,(H,16,18) |
| InChIKey | AUUAPGGVMNYTIJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|