C10H12N2O3S — CID 82084502
1,1-dioxo-2-propyl-4H-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 82084502) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 1,1-dioxo-2-propyl-4H-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 1,1-dioxo-2-propyl-4H-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 82084502 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1,1-dioxo-2-propyl-4H-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | CCCN1C(=O)Nc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C10H12N2O3S/c1-2-7-12-10(13)11-8-5-3-4-6-9(8)16(12,14)15/h3-6H,2,7H2,1H3,(H,11,13) |
| InChIKey | XJNJLXGZHPIZOR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |