C9H15NS — CID 123924880
N,N-diethyl-2H-thiopyran-2-amine (PubChem CID 123924880) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is N,N-diethyl-2H-thiopyran-2-amine.
| Compound Name | N,N-diethyl-2H-thiopyran-2-amine |
|---|---|
| PubChem CID | 123924880 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | N,N-diethyl-2H-thiopyran-2-amine |
| SMILES | CCN(CC)C1C=CC=CS1 |
| InChI | InChI=1S/C9H15NS/c1-3-10(4-2)9-7-5-6-8-11-9/h5-9H,3-4H2,1-2H3 |
| InChIKey | JWHFERUEKHMFMR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |