C15H21N — CID 123925025
N-(2-methylprop-2-enyl)-5-prop-2-enylidenespiro[2.5]octan-8-imine (PubChem CID 123925025) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is N-(2-methylprop-2-enyl)-5-prop-2-enylidenespiro[2.5]octan-8-imine.
| Compound Name | N-(2-methylprop-2-enyl)-5-prop-2-enylidenespiro[2.5]octan-8-imine |
|---|---|
| PubChem CID | 123925025 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N-(2-methylprop-2-enyl)-5-prop-2-enylidenespiro[2.5]octan-8-imine |
| SMILES | C=CC=C1CC/C(=N\CC(=C)C)C2(CC2)C1 |
| InChI | InChI=1S/C15H21N/c1-4-5-13-6-7-14(16-11-12(2)3)15(10-13)8-9-15/h4-5H,1-2,6-11H2,3H3/b13-5?,16-14+ |
| InChIKey | ATRYVBGHXNBUJT-ZOGTVQCMSA-N |
| XLogP | 4.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|