C29H42N4O6S2 — CID 123925703
S-[4-[(7S,10S)-2,5,8,12-tetraoxo-7-propan-2-ylspiro[9-oxa-16-thia-3,6,13,18-tetrazabicyclo[13.2.1]octadeca-1(17),15(18)-diene-4,1'-cyclopropane]-10-yl]but-3-enyl] octanethioate (PubChem CID 123925703) has the molecular formula C29H42N4O6S2 and a molecular weight of 606.81 g/mol. Its IUPAC name is S-[4-[(7S,10S)-2,5,8,12-tetraoxo-7-propan-2-ylspiro[9-oxa-16-thia-3,6,13,18-tetrazabicyclo[13.2.1]octadeca-1(17),15(18)-diene-4,1'-cyclopropane]-10-yl]but-3-enyl] octanethioate.
| Compound Name | S-[4-[(7S,10S)-2,5,8,12-tetraoxo-7-propan-2-ylspiro[9-oxa-16-thia-3,6,13,18-tetrazabicyclo[13.2.1]octadeca-1(17),15(18)-diene-4,1'-cyclopropane]-10-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 123925703 |
| Molecular Formula | C29H42N4O6S2 |
| Molecular Weight | 606.81 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | S-[4-[(7S,10S)-2,5,8,12-tetraoxo-7-propan-2-ylspiro[9-oxa-16-thia-3,6,13,18-tetrazabicyclo[13.2.1]octadeca-1(17),15(18)-diene-4,1'-cyclopropane]-10-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCCC=C[C@@H]1CC(=O)NCc2nc(cs2)C(=O)NC2(CC2)C(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C29H42N4O6S2/c1-4-5-6-7-8-12-24(35)40-15-10-9-11-20-16-22(34)30-17-23-31-21(18-41-23)26(36)33-29(13-14-29)28(38)32-25(19(2)3)27(37)39-20/h9,11,18-20,25H,4-8,10,12-17H2,1-3H3,(H,30,34)(H,32,38)(H,33,36)/t20-,25+/m1/s1 |
| InChIKey | GWZPTHGOVDPSIZ-NLFFAJNJSA-N |
| XLogP | 4.04 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.81 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|